C16H18N4O6 — CID 18706551
5-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-7-nitro-1,4-dihydroquinoxaline-2,3-dione (PubChem CID 18706551) has the molecular formula C16H18N4O6 and a molecular weight of 362.34 g/mol. Its IUPAC name is 5-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-7-nitro-1,4-dihydroquinoxaline-2,3-dione.
| Compound Name | 5-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-7-nitro-1,4-dihydroquinoxaline-2,3-dione |
|---|---|
| PubChem CID | 18706551 |
| Molecular Formula | C16H18N4O6 |
| Molecular Weight | 362.34 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | 5-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-7-nitro-1,4-dihydroquinoxaline-2,3-dione |
| SMILES | O=c1[nH]c2cc([N+](=O)[O-])cc(CN3CCC4(CC3)OCCO4)c2[nH]c1=O |
| InChI | InChI=1S/C16H18N4O6/c21-14-15(22)18-13-10(7-11(20(23)24)8-12(13)17-14)9-19-3-1-16(2-4-19)25-5-6-26-16/h7-8H,1-6,9H2,(H,17,21)(H,18,22) |
| InChIKey | HDLAFOXWTXSFEA-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 130.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.34 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|