C16H13N5O6 — CID 172785797
2-[amino-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methyl]amino]benzoic acid (PubChem CID 172785797) has the molecular formula C16H13N5O6 and a molecular weight of 371.31 g/mol. Its IUPAC name is 2-[amino-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methyl]amino]benzoic acid.
| Compound Name | 2-[amino-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methyl]amino]benzoic acid |
|---|---|
| PubChem CID | 172785797 |
| Molecular Formula | C16H13N5O6 |
| Molecular Weight | 371.31 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | 2-[amino-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methyl]amino]benzoic acid |
| SMILES | NN(Cc1cc([N+](=O)[O-])cc2[nH]c(=O)c(=O)[nH]c12)c1ccccc1C(=O)O |
| InChI | InChI=1S/C16H13N5O6/c17-20(12-4-2-1-3-10(12)16(24)25)7-8-5-9(21(26)27)6-11-13(8)19-15(23)14(22)18-11/h1-6H,7,17H2,(H,18,22)(H,19,23)(H,24,25) |
| InChIKey | OWILWAUAMRMRGY-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 175.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.31 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|