C20H15N5O5 — CID 70272653
N-[2-(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)ethyl]quinoline-4-carboxamide (PubChem CID 70272653) has the molecular formula C20H15N5O5 and a molecular weight of 405.37 g/mol. Its IUPAC name is N-[2-(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)ethyl]quinoline-4-carboxamide.
| Compound Name | N-[2-(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)ethyl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 70272653 |
| Molecular Formula | C20H15N5O5 |
| Molecular Weight | 405.37 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | N-[2-(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)ethyl]quinoline-4-carboxamide |
| SMILES | O=C(NCCc1cc([N+](=O)[O-])cc2[nH]c(=O)c(=O)[nH]c12)c1ccnc2ccccc12 |
| InChI | InChI=1S/C20H15N5O5/c26-18(14-6-8-21-15-4-2-1-3-13(14)15)22-7-5-11-9-12(25(29)30)10-16-17(11)24-20(28)19(27)23-16/h1-4,6,8-10H,5,7H2,(H,22,26)(H,23,27)(H,24,28) |
| InChIKey | DRQSKJVGFKDYQD-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 150.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.37 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|