C12H15N4O7P — CID 10383749
[(1R)-1-(dimethylamino)-2-(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)ethyl]phosphonic acid (PubChem CID 10383749) has the molecular formula C12H15N4O7P and a molecular weight of 358.25 g/mol. Its IUPAC name is [(1R)-1-(dimethylamino)-2-(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)ethyl]phosphonic acid.
| Compound Name | [(1R)-1-(dimethylamino)-2-(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)ethyl]phosphonic acid |
|---|---|
| PubChem CID | 10383749 |
| Molecular Formula | C12H15N4O7P |
| Molecular Weight | 358.25 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | [(1R)-1-(dimethylamino)-2-(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)ethyl]phosphonic acid |
| SMILES | CN(C)[C@@H](Cc1cc([N+](=O)[O-])cc2[nH]c(=O)c(=O)[nH]c12)P(=O)(O)O |
| InChI | InChI=1S/C12H15N4O7P/c1-15(2)9(24(21,22)23)4-6-3-7(16(19)20)5-8-10(6)14-12(18)11(17)13-8/h3,5,9H,4H2,1-2H3,(H,13,17)(H,14,18)(H2,21,22,23)/t9-/m1/s1 |
| InChIKey | DZTAYQIPSPUMKT-SECBINFHSA-N |
| XLogP | -0.27 |
| TPSA | 169.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.25 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|