C23H22BrN4O6P — CID 45259282
benzyl-[(benzylamino)-(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methyl]phosphinic acid;hydrobromide (PubChem CID 45259282) has the molecular formula C23H22BrN4O6P and a molecular weight of 561.33 g/mol. Its IUPAC name is benzyl-[(benzylamino)-(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methyl]phosphinic acid;hydrobromide.
| Compound Name | benzyl-[(benzylamino)-(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methyl]phosphinic acid;hydrobromide |
|---|---|
| PubChem CID | 45259282 |
| Molecular Formula | C23H22BrN4O6P |
| Molecular Weight | 561.33 g/mol |
| Exact Mass | 560.05 |
| IUPAC Name | benzyl-[(benzylamino)-(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methyl]phosphinic acid;hydrobromide |
| SMILES | Br.O=c1[nH]c2cc([N+](=O)[O-])cc(C(NCc3ccccc3)P(=O)(O)Cc3ccccc3)c2[nH]c1=O |
| InChI | InChI=1S/C23H21N4O6P.BrH/c28-21-22(29)26-20-18(11-17(27(30)31)12-19(20)25-21)23(24-13-15-7-3-1-4-8-15)34(32,33)14-16-9-5-2-6-10-16;/h1-12,23-24H,13-14H2,(H,25,28)(H,26,29)(H,32,33);1H |
| InChIKey | NRUMCMSOKVFYJL-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 158.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.33 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|