C17H17N4O7P — CID 101157734
[(R)-(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)-[[(1S)-1-phenylethyl]amino]methyl]phosphonic acid (PubChem CID 101157734) has the molecular formula C17H17N4O7P and a molecular weight of 420.32 g/mol. Its IUPAC name is [(R)-(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)-[[(1S)-1-phenylethyl]amino]methyl]phosphonic acid.
| Compound Name | [(R)-(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)-[[(1S)-1-phenylethyl]amino]methyl]phosphonic acid |
|---|---|
| PubChem CID | 101157734 |
| Molecular Formula | C17H17N4O7P |
| Molecular Weight | 420.32 g/mol |
| Exact Mass | 420.08 |
| IUPAC Name | [(R)-(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)-[[(1S)-1-phenylethyl]amino]methyl]phosphonic acid |
| SMILES | C[C@H](N[C@@H](c1cc([N+](=O)[O-])cc2[nH]c(=O)c(=O)[nH]c12)P(=O)(O)O)c1ccccc1 |
| InChI | InChI=1S/C17H17N4O7P/c1-9(10-5-3-2-4-6-10)18-17(29(26,27)28)12-7-11(21(24)25)8-13-14(12)20-16(23)15(22)19-13/h2-9,17-18H,1H3,(H,19,22)(H,20,23)(H2,26,27,28)/t9-,17+/m0/s1 |
| InChIKey | NZZJCJMILAZTBL-HUTHGQBESA-N |
| XLogP | 1.65 |
| TPSA | 178.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.32 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|