C7H13N4O4P — CID 46931287
[[(2S)-1-amino-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]amino]methylphosphonic acid (PubChem CID 46931287) has the molecular formula C7H13N4O4P and a molecular weight of 248.18 g/mol. Its IUPAC name is [[(2S)-1-amino-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]amino]methylphosphonic acid.
| Compound Name | [[(2S)-1-amino-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]amino]methylphosphonic acid |
|---|---|
| PubChem CID | 46931287 |
| Molecular Formula | C7H13N4O4P |
| Molecular Weight | 248.18 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | [[(2S)-1-amino-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]amino]methylphosphonic acid |
| SMILES | NC(=O)[C@H](Cc1cnc[nH]1)NCP(=O)(O)O |
| InChI | InChI=1S/C7H13N4O4P/c8-7(12)6(11-4-16(13,14)15)1-5-2-9-3-10-5/h2-3,6,11H,1,4H2,(H2,8,12)(H,9,10)(H2,13,14,15)/t6-/m0/s1 |
| InChIKey | XYWDVBPPARNKMU-LURJTMIESA-N |
| XLogP | -1.47 |
| TPSA | 141.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.18 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|