C8H15N4O4P — CID 68512936
2-[[1-amino-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]amino]ethylphosphonic acid (PubChem CID 68512936) has the molecular formula C8H15N4O4P and a molecular weight of 262.21 g/mol. Its IUPAC name is 2-[[1-amino-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]amino]ethylphosphonic acid.
| Compound Name | 2-[[1-amino-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]amino]ethylphosphonic acid |
|---|---|
| PubChem CID | 68512936 |
| Molecular Formula | C8H15N4O4P |
| Molecular Weight | 262.21 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | 2-[[1-amino-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]amino]ethylphosphonic acid |
| SMILES | NC(=O)C(Cc1cnc[nH]1)NCCP(=O)(O)O |
| InChI | InChI=1S/C8H15N4O4P/c9-8(13)7(3-6-4-10-5-12-6)11-1-2-17(14,15)16/h4-5,7,11H,1-3H2,(H2,9,13)(H,10,12)(H2,14,15,16) |
| InChIKey | NGHOQLJFUUUCFC-UHFFFAOYSA-N |
| XLogP | -1.43 |
| TPSA | 141.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.21 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|