C9H15N3O2 — CID 130225450
ethyl (2R)-3-(1H-imidazol-5-yl)-2-(methylamino)propanoate (PubChem CID 130225450) has the molecular formula C9H15N3O2 and a molecular weight of 197.24 g/mol. Its IUPAC name is ethyl (2R)-3-(1H-imidazol-5-yl)-2-(methylamino)propanoate.
| Compound Name | ethyl (2R)-3-(1H-imidazol-5-yl)-2-(methylamino)propanoate |
|---|---|
| PubChem CID | 130225450 |
| Molecular Formula | C9H15N3O2 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | ethyl (2R)-3-(1H-imidazol-5-yl)-2-(methylamino)propanoate |
| SMILES | CCOC(=O)[C@@H](Cc1cnc[nH]1)NC |
| InChI | InChI=1S/C9H15N3O2/c1-3-14-9(13)8(10-2)4-7-5-11-6-12-7/h5-6,8,10H,3-4H2,1-2H3,(H,11,12)/t8-/m1/s1 |
| InChIKey | HSHQLHOYYFPWSQ-MRVPVSSYSA-N |
| XLogP | 0.10 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |