C11H21Cl2N3O2 — CID 68602935
butyl (2S)-3-(1H-imidazol-5-yl)-2-(methylamino)propanoate;dihydrochloride (PubChem CID 68602935) has the molecular formula C11H21Cl2N3O2 and a molecular weight of 298.21 g/mol. Its IUPAC name is butyl (2S)-3-(1H-imidazol-5-yl)-2-(methylamino)propanoate;dihydrochloride.
| Compound Name | butyl (2S)-3-(1H-imidazol-5-yl)-2-(methylamino)propanoate;dihydrochloride |
|---|---|
| PubChem CID | 68602935 |
| Molecular Formula | C11H21Cl2N3O2 |
| Molecular Weight | 298.21 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | butyl (2S)-3-(1H-imidazol-5-yl)-2-(methylamino)propanoate;dihydrochloride |
| SMILES | CCCCOC(=O)[C@H](Cc1cnc[nH]1)NC.Cl.Cl |
| InChI | InChI=1S/C11H19N3O2.2ClH/c1-3-4-5-16-11(15)10(12-2)6-9-7-13-8-14-9;;/h7-8,10,12H,3-6H2,1-2H3,(H,13,14);2*1H/t10-;;/m0../s1 |
| InChIKey | XHWLEZZHAHLXSB-XRIOVQLTSA-N |
| XLogP | 1.73 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.21 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|