C15H19N3O2 — CID 68601582
(4-methylphenyl)methyl (2S)-3-(1H-imidazol-5-yl)-2-(methylamino)propanoate (PubChem CID 68601582) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is (4-methylphenyl)methyl (2S)-3-(1H-imidazol-5-yl)-2-(methylamino)propanoate.
| Compound Name | (4-methylphenyl)methyl (2S)-3-(1H-imidazol-5-yl)-2-(methylamino)propanoate |
|---|---|
| PubChem CID | 68601582 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | (4-methylphenyl)methyl (2S)-3-(1H-imidazol-5-yl)-2-(methylamino)propanoate |
| SMILES | CN[C@@H](Cc1cnc[nH]1)C(=O)OCc1ccc(C)cc1 |
| InChI | InChI=1S/C15H19N3O2/c1-11-3-5-12(6-4-11)9-20-15(19)14(16-2)7-13-8-17-10-18-13/h3-6,8,10,14,16H,7,9H2,1-2H3,(H,17,18)/t14-/m0/s1 |
| InChIKey | AVGLPYRRVRTAFC-AWEZNQCLSA-N |
| XLogP | 1.59 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |