C20H20ClN3O — CID 89070857
(3S)-3-(chloroamino)-4-(1H-imidazol-5-yl)-1-[4-(4-methylphenyl)phenyl]butan-2-one (PubChem CID 89070857) has the molecular formula C20H20ClN3O and a molecular weight of 353.85 g/mol. Its IUPAC name is (3S)-3-(chloroamino)-4-(1H-imidazol-5-yl)-1-[4-(4-methylphenyl)phenyl]butan-2-one.
| Compound Name | (3S)-3-(chloroamino)-4-(1H-imidazol-5-yl)-1-[4-(4-methylphenyl)phenyl]butan-2-one |
|---|---|
| PubChem CID | 89070857 |
| Molecular Formula | C20H20ClN3O |
| Molecular Weight | 353.85 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | (3S)-3-(chloroamino)-4-(1H-imidazol-5-yl)-1-[4-(4-methylphenyl)phenyl]butan-2-one |
| SMILES | Cc1ccc(-c2ccc(CC(=O)[C@H](Cc3cnc[nH]3)NCl)cc2)cc1 |
| InChI | InChI=1S/C20H20ClN3O/c1-14-2-6-16(7-3-14)17-8-4-15(5-9-17)10-20(25)19(24-21)11-18-12-22-13-23-18/h2-9,12-13,19,24H,10-11H2,1H3,(H,22,23)/t19-/m0/s1 |
| InChIKey | XLZSYOIBCMHDAN-IBGZPJMESA-N |
| XLogP | 3.85 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.85 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|