C14H16N4O3 — CID 103870457
(2R)-2-[[2-(4-aminophenyl)acetyl]amino]-3-(1H-imidazol-5-yl)propanoic acid (PubChem CID 103870457) has the molecular formula C14H16N4O3 and a molecular weight of 288.31 g/mol. Its IUPAC name is (2R)-2-[[2-(4-aminophenyl)acetyl]amino]-3-(1H-imidazol-5-yl)propanoic acid.
| Compound Name | (2R)-2-[[2-(4-aminophenyl)acetyl]amino]-3-(1H-imidazol-5-yl)propanoic acid |
|---|---|
| PubChem CID | 103870457 |
| Molecular Formula | C14H16N4O3 |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | (2R)-2-[[2-(4-aminophenyl)acetyl]amino]-3-(1H-imidazol-5-yl)propanoic acid |
| SMILES | Nc1ccc(CC(=O)N[C@H](Cc2cnc[nH]2)C(=O)O)cc1 |
| InChI | InChI=1S/C14H16N4O3/c15-10-3-1-9(2-4-10)5-13(19)18-12(14(20)21)6-11-7-16-8-17-11/h1-4,7-8,12H,5-6,15H2,(H,16,17)(H,18,19)(H,20,21)/t12-/m1/s1 |
| InChIKey | XDLUXCAHFABSPR-GFCCVEGCSA-N |
| XLogP | 0.35 |
| TPSA | 121.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|