C11H18N6O3 — CID 71362423
(2S)-2-[4-(hydrazinylmethylideneamino)butanoylamino]-3-(1H-imidazol-5-yl)propanoic acid (PubChem CID 71362423) has the molecular formula C11H18N6O3 and a molecular weight of 282.30 g/mol. Its IUPAC name is (2S)-2-[4-(hydrazinylmethylideneamino)butanoylamino]-3-(1H-imidazol-5-yl)propanoic acid.
| Compound Name | (2S)-2-[4-(hydrazinylmethylideneamino)butanoylamino]-3-(1H-imidazol-5-yl)propanoic acid |
|---|---|
| PubChem CID | 71362423 |
| Molecular Formula | C11H18N6O3 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | (2S)-2-[4-(hydrazinylmethylideneamino)butanoylamino]-3-(1H-imidazol-5-yl)propanoic acid |
| SMILES | NN/C=N/CCCC(=O)N[C@@H](Cc1cnc[nH]1)C(=O)O |
| InChI | InChI=1S/C11H18N6O3/c12-16-7-13-3-1-2-10(18)17-9(11(19)20)4-8-5-14-6-15-8/h5-7,9H,1-4,12H2,(H,13,16)(H,14,15)(H,17,18)(H,19,20)/t9-/m0/s1 |
| InChIKey | WBUDTPSHUIHUFB-VIFPVBQESA-N |
| XLogP | -1.21 |
| TPSA | 145.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|