C6H8ClN3NaO2 — CID 162305209
CID 162305209 (PubChem CID 162305209) has the molecular formula C6H8ClN3NaO2 and a molecular weight of 212.59 g/mol.
| Compound Name | CID 162305209 |
|---|---|
| PubChem CID | 162305209 |
| Molecular Formula | C6H8ClN3NaO2 |
| Molecular Weight | 212.59 g/mol |
| Exact Mass | 212.02 |
| IUPAC Name | — |
| SMILES | O=C(O)[C@H](Cc1cnc[nH]1)NCl.[Na] |
| InChI | InChI=1S/C6H8ClN3O2.Na/c7-10-5(6(11)12)1-4-2-8-3-9-4;/h2-3,5,10H,1H2,(H,8,9)(H,11,12);/t5-;/m0./s1 |
| InChIKey | PZAVCYCWFVOGSS-JEDNCBNOSA-N |
| XLogP | -0.23 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.59 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|