C16H29N3O2 — CID 176896524
decyl (2S)-2-amino-3-(1H-imidazol-5-yl)propanoate (PubChem CID 176896524) has the molecular formula C16H29N3O2 and a molecular weight of 295.43 g/mol. Its IUPAC name is decyl (2S)-2-amino-3-(1H-imidazol-5-yl)propanoate.
| Compound Name | decyl (2S)-2-amino-3-(1H-imidazol-5-yl)propanoate |
|---|---|
| PubChem CID | 176896524 |
| Molecular Formula | C16H29N3O2 |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.23 |
| IUPAC Name | decyl (2S)-2-amino-3-(1H-imidazol-5-yl)propanoate |
| SMILES | CCCCCCCCCCOC(=O)[C@@H](N)Cc1cnc[nH]1 |
| InChI | InChI=1S/C16H29N3O2/c1-2-3-4-5-6-7-8-9-10-21-16(20)15(17)11-14-12-18-13-19-14/h12-13,15H,2-11,17H2,1H3,(H,18,19)/t15-/m0/s1 |
| InChIKey | OFSQLMVGEYWNCJ-HNNXBMFYSA-N |
| XLogP | 2.96 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|