C12H21N3O2 — CID 66224172
3,3-dimethylbutyl (2S)-2-amino-3-(1H-imidazol-5-yl)propanoate (PubChem CID 66224172) has the molecular formula C12H21N3O2 and a molecular weight of 239.32 g/mol. Its IUPAC name is 3,3-dimethylbutyl (2S)-2-amino-3-(1H-imidazol-5-yl)propanoate.
| Compound Name | 3,3-dimethylbutyl (2S)-2-amino-3-(1H-imidazol-5-yl)propanoate |
|---|---|
| PubChem CID | 66224172 |
| Molecular Formula | C12H21N3O2 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.16 |
| IUPAC Name | 3,3-dimethylbutyl (2S)-2-amino-3-(1H-imidazol-5-yl)propanoate |
| SMILES | CC(C)(C)CCOC(=O)[C@@H](N)Cc1cnc[nH]1 |
| InChI | InChI=1S/C12H21N3O2/c1-12(2,3)4-5-17-11(16)10(13)6-9-7-14-8-15-9/h7-8,10H,4-6,13H2,1-3H3,(H,14,15)/t10-/m0/s1 |
| InChIKey | JLHHSUYQGQNIAQ-JTQLQIEISA-N |
| XLogP | 1.26 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |