C11H21N3O2Si — CID 57194966
2-trimethylsilylethyl 2-amino-3-(1H-imidazol-5-yl)propanoate (PubChem CID 57194966) has the molecular formula C11H21N3O2Si and a molecular weight of 255.39 g/mol. Its IUPAC name is 2-trimethylsilylethyl 2-amino-3-(1H-imidazol-5-yl)propanoate.
| Compound Name | 2-trimethylsilylethyl 2-amino-3-(1H-imidazol-5-yl)propanoate |
|---|---|
| PubChem CID | 57194966 |
| Molecular Formula | C11H21N3O2Si |
| Molecular Weight | 255.39 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | 2-trimethylsilylethyl 2-amino-3-(1H-imidazol-5-yl)propanoate |
| SMILES | C[Si](C)(C)CCOC(=O)C(N)Cc1cnc[nH]1 |
| InChI | InChI=1S/C11H21N3O2Si/c1-17(2,3)5-4-16-11(15)10(12)6-9-7-13-8-14-9/h7-8,10H,4-6,12H2,1-3H3,(H,13,14) |
| InChIKey | HRRPZZBSDYIHRQ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.39 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|