C13H23N3O5 — CID 104563198
2-[2-(2-methoxyethoxy)ethoxy]ethyl 2-amino-3-(1H-imidazol-5-yl)propanoate (PubChem CID 104563198) has the molecular formula C13H23N3O5 and a molecular weight of 301.34 g/mol. Its IUPAC name is 2-[2-(2-methoxyethoxy)ethoxy]ethyl 2-amino-3-(1H-imidazol-5-yl)propanoate.
| Compound Name | 2-[2-(2-methoxyethoxy)ethoxy]ethyl 2-amino-3-(1H-imidazol-5-yl)propanoate |
|---|---|
| PubChem CID | 104563198 |
| Molecular Formula | C13H23N3O5 |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.16 |
| IUPAC Name | 2-[2-(2-methoxyethoxy)ethoxy]ethyl 2-amino-3-(1H-imidazol-5-yl)propanoate |
| SMILES | COCCOCCOCCOC(=O)C(N)Cc1cnc[nH]1 |
| InChI | InChI=1S/C13H23N3O5/c1-18-2-3-19-4-5-20-6-7-21-13(17)12(14)8-11-9-15-10-16-11/h9-10,12H,2-8,14H2,1H3,(H,15,16) |
| InChIKey | VUBOTOWQFMEKPH-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 108.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|