C15H15N5O5 — CID 70271856
5-[(5-amino-2-methoxy-2H-pyridin-1-yl)methyl]-7-nitro-1,4-dihydroquinoxaline-2,3-dione (PubChem CID 70271856) has the molecular formula C15H15N5O5 and a molecular weight of 345.32 g/mol. Its IUPAC name is 5-[(5-amino-2-methoxy-2H-pyridin-1-yl)methyl]-7-nitro-1,4-dihydroquinoxaline-2,3-dione.
| Compound Name | 5-[(5-amino-2-methoxy-2H-pyridin-1-yl)methyl]-7-nitro-1,4-dihydroquinoxaline-2,3-dione |
|---|---|
| PubChem CID | 70271856 |
| Molecular Formula | C15H15N5O5 |
| Molecular Weight | 345.32 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | 5-[(5-amino-2-methoxy-2H-pyridin-1-yl)methyl]-7-nitro-1,4-dihydroquinoxaline-2,3-dione |
| SMILES | COC1C=CC(N)=CN1Cc1cc([N+](=O)[O-])cc2[nH]c(=O)c(=O)[nH]c12 |
| InChI | InChI=1S/C15H15N5O5/c1-25-12-3-2-9(16)7-19(12)6-8-4-10(20(23)24)5-11-13(8)18-15(22)14(21)17-11/h2-5,7,12H,6,16H2,1H3,(H,17,21)(H,18,22) |
| InChIKey | VFQCQTWXWSJKKE-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 147.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.32 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|