C16H18BrN5O6S — CID 70271850
ethyl 2-[2-amino-3-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methyl]-2H-1,3-thiazol-4-yl]acetate;hydrobromide (PubChem CID 70271850) has the molecular formula C16H18BrN5O6S and a molecular weight of 488.32 g/mol. Its IUPAC name is ethyl 2-[2-amino-3-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methyl]-2H-1,3-thiazol-4-yl]acetate;hydrobromide.
| Compound Name | ethyl 2-[2-amino-3-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methyl]-2H-1,3-thiazol-4-yl]acetate;hydrobromide |
|---|---|
| PubChem CID | 70271850 |
| Molecular Formula | C16H18BrN5O6S |
| Molecular Weight | 488.32 g/mol |
| Exact Mass | 487.02 |
| IUPAC Name | ethyl 2-[2-amino-3-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methyl]-2H-1,3-thiazol-4-yl]acetate;hydrobromide |
| SMILES | Br.CCOC(=O)CC1=CSC(N)N1Cc1cc([N+](=O)[O-])cc2[nH]c(=O)c(=O)[nH]c12 |
| InChI | InChI=1S/C16H17N5O6S.BrH/c1-2-27-12(22)5-10-7-28-16(17)20(10)6-8-3-9(21(25)26)4-11-13(8)19-15(24)14(23)18-11;/h3-4,7,16H,2,5-6,17H2,1H3,(H,18,23)(H,19,24);1H |
| InChIKey | ZSCLNBQQEXHIBG-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 164.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.32 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|