C14H18ClN5O6S — CID 174358596
2-[2-amino-3-[(2,3-dihydroxy-7-nitro-1,2,3,4-tetrahydroquinoxalin-5-yl)methyl]-2H-1,3-thiazol-4-yl]acetic acid;hydrochloride (PubChem CID 174358596) has the molecular formula C14H18ClN5O6S and a molecular weight of 419.85 g/mol. Its IUPAC name is 2-[2-amino-3-[(2,3-dihydroxy-7-nitro-1,2,3,4-tetrahydroquinoxalin-5-yl)methyl]-2H-1,3-thiazol-4-yl]acetic acid;hydrochloride.
| Compound Name | 2-[2-amino-3-[(2,3-dihydroxy-7-nitro-1,2,3,4-tetrahydroquinoxalin-5-yl)methyl]-2H-1,3-thiazol-4-yl]acetic acid;hydrochloride |
|---|---|
| PubChem CID | 174358596 |
| Molecular Formula | C14H18ClN5O6S |
| Molecular Weight | 419.85 g/mol |
| Exact Mass | 419.07 |
| IUPAC Name | 2-[2-amino-3-[(2,3-dihydroxy-7-nitro-1,2,3,4-tetrahydroquinoxalin-5-yl)methyl]-2H-1,3-thiazol-4-yl]acetic acid;hydrochloride |
| SMILES | Cl.NC1SC=C(CC(=O)O)N1Cc1cc([N+](=O)[O-])cc2c1NC(O)C(O)N2 |
| InChI | InChI=1S/C14H17N5O6S.ClH/c15-14-18(8(5-26-14)3-10(20)21)4-6-1-7(19(24)25)2-9-11(6)17-13(23)12(22)16-9;/h1-2,5,12-14,16-17,22-23H,3-4,15H2,(H,20,21);1H |
| InChIKey | PBQRLYDGZOKVCE-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 174.22 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.85 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|