C7H6N2O5 — CID 83814946
2-(5-nitro-2-oxo-1H-pyridin-3-yl)acetic acid (PubChem CID 83814946) has the molecular formula C7H6N2O5 and a molecular weight of 198.13 g/mol. Its IUPAC name is 2-(5-nitro-2-oxo-1H-pyridin-3-yl)acetic acid.
| Compound Name | 2-(5-nitro-2-oxo-1H-pyridin-3-yl)acetic acid |
|---|---|
| PubChem CID | 83814946 |
| Molecular Formula | C7H6N2O5 |
| Molecular Weight | 198.13 g/mol |
| Exact Mass | 198.03 |
| IUPAC Name | 2-(5-nitro-2-oxo-1H-pyridin-3-yl)acetic acid |
| SMILES | O=C(O)Cc1cc([N+](=O)[O-])c[nH]c1=O |
| InChI | InChI=1S/C7H6N2O5/c10-6(11)2-4-1-5(9(13)14)3-8-7(4)12/h1,3H,2H2,(H,8,12)(H,10,11) |
| InChIKey | UPUQUVGJMORMOZ-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 113.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.13 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|