C6H6N4O4 — CID 43244604
5-nitro-2-oxo-1H-pyridine-3-carbohydrazide (PubChem CID 43244604) has the molecular formula C6H6N4O4 and a molecular weight of 198.14 g/mol. Its IUPAC name is 5-nitro-2-oxo-1H-pyridine-3-carbohydrazide.
| Compound Name | 5-nitro-2-oxo-1H-pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 43244604 |
| Molecular Formula | C6H6N4O4 |
| Molecular Weight | 198.14 g/mol |
| Exact Mass | 198.04 |
| IUPAC Name | 5-nitro-2-oxo-1H-pyridine-3-carbohydrazide |
| SMILES | NNC(=O)c1cc([N+](=O)[O-])c[nH]c1=O |
| InChI | InChI=1S/C6H6N4O4/c7-9-6(12)4-1-3(10(13)14)2-8-5(4)11/h1-2H,7H2,(H,8,11)(H,9,12) |
| InChIKey | PRGXOOIELWEGGN-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 131.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.14 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|