C12H18N4O5 — CID 103841090
N-[3-(dimethylamino)-2-hydroxy-2-methylpropyl]-5-nitro-2-oxo-1H-pyridine-3-carboxamide (PubChem CID 103841090) has the molecular formula C12H18N4O5 and a molecular weight of 298.30 g/mol. Its IUPAC name is N-[3-(dimethylamino)-2-hydroxy-2-methylpropyl]-5-nitro-2-oxo-1H-pyridine-3-carboxamide.
| Compound Name | N-[3-(dimethylamino)-2-hydroxy-2-methylpropyl]-5-nitro-2-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 103841090 |
| Molecular Formula | C12H18N4O5 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | N-[3-(dimethylamino)-2-hydroxy-2-methylpropyl]-5-nitro-2-oxo-1H-pyridine-3-carboxamide |
| SMILES | CN(C)CC(C)(O)CNC(=O)c1cc([N+](=O)[O-])c[nH]c1=O |
| InChI | InChI=1S/C12H18N4O5/c1-12(19,7-15(2)3)6-14-11(18)9-4-8(16(20)21)5-13-10(9)17/h4-5,19H,6-7H2,1-3H3,(H,13,17)(H,14,18) |
| InChIKey | KJWFJWCMWFGLJX-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 128.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|