C10H11N3O6 — CID 43409764
methyl 2-[methyl-(5-nitro-2-oxo-1H-pyridine-3-carbonyl)amino]acetate (PubChem CID 43409764) has the molecular formula C10H11N3O6 and a molecular weight of 269.21 g/mol. Its IUPAC name is methyl 2-[methyl-(5-nitro-2-oxo-1H-pyridine-3-carbonyl)amino]acetate.
| Compound Name | methyl 2-[methyl-(5-nitro-2-oxo-1H-pyridine-3-carbonyl)amino]acetate |
|---|---|
| PubChem CID | 43409764 |
| Molecular Formula | C10H11N3O6 |
| Molecular Weight | 269.21 g/mol |
| Exact Mass | 269.06 |
| IUPAC Name | methyl 2-[methyl-(5-nitro-2-oxo-1H-pyridine-3-carbonyl)amino]acetate |
| SMILES | COC(=O)CN(C)C(=O)c1cc([N+](=O)[O-])c[nH]c1=O |
| InChI | InChI=1S/C10H11N3O6/c1-12(5-8(14)19-2)10(16)7-3-6(13(17)18)4-11-9(7)15/h3-4H,5H2,1-2H3,(H,11,15) |
| InChIKey | YUNNNROGNZTYBA-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 122.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.21 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|