methyl 2-[(2,5-difluoro-4-nitrobenzoyl)-methylamino]acetate

C11H10F2N2O5 — CID 115880321

IUPACmethyl 2-[(2,5-difluoro-4-nitrobenzoyl)-methylamino]acetate
SMILESCOC(=O)CN(C)C(=O)c1cc(F)c([N+](=O)[O-])cc1F
InChIInChI=1S/C11H10F2N2O5/c1-14(5-10(16)20-2)11(17)6-3-8(13)9(15(18)19)4-7(6)12/h3-4H,5H2,1-2H3
InChIKeySOWVQEGCXNVJMF-UHFFFAOYSA-N
MW288.21 g/mol
LogP1.12
Rot. Bonds4

About methyl 2-[(2,5-difluoro-4-nitrobenzoyl)-methylamino]acetate

methyl 2-[(2,5-difluoro-4-nitrobenzoyl)-methylamino]acetate (PubChem CID 115880321) has the molecular formula C11H10F2N2O5 and a molecular weight of 288.21 g/mol. Its IUPAC name is methyl 2-[(2,5-difluoro-4-nitrobenzoyl)-methylamino]acetate.

Molecular Properties

Compound Namemethyl 2-[(2,5-difluoro-4-nitrobenzoyl)-methylamino]acetate
PubChem CID115880321
Molecular FormulaC11H10F2N2O5
Molecular Weight288.21 g/mol
Exact Mass288.06
IUPAC Namemethyl 2-[(2,5-difluoro-4-nitrobenzoyl)-methylamino]acetate
SMILESCOC(=O)CN(C)C(=O)c1cc(F)c([N+](=O)[O-])cc1F
InChIInChI=1S/C11H10F2N2O5/c1-14(5-10(16)20-2)11(17)6-3-8(13)9(15(18)19)4-7(6)12/h3-4H,5H2,1-2H3
InChIKeySOWVQEGCXNVJMF-UHFFFAOYSA-N
XLogP1.12
TPSA89.75 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500288.21
LogP ≤ 51.12
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze methyl 2-[(2,5-difluoro-4-nitrobenzoyl)-methylamino]acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[(2,5-difluoro-4-nitrobenzoyl)-methylamino]acetate?
The IUPAC name of methyl 2-[(2,5-difluoro-4-nitrobenzoyl)-methylamino]acetate (CID 115880321) is methyl 2-[(2,5-difluoro-4-nitrobenzoyl)-methylamino]acetate.
What is the SMILES notation for methyl 2-[(2,5-difluoro-4-nitrobenzoyl)-methylamino]acetate?
The canonical SMILES for methyl 2-[(2,5-difluoro-4-nitrobenzoyl)-methylamino]acetate is COC(=O)CN(C)C(=O)c1cc(F)c([N+](=O)[O-])cc1F.
What is the InChIKey of methyl 2-[(2,5-difluoro-4-nitrobenzoyl)-methylamino]acetate?
The InChIKey is SOWVQEGCXNVJMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10F2N2O5/c1-14(5-10(16)20-2)11(17)6-3-8(13)9(15(18)19)4-7(6)12/h3-4H,5H2,1-2H3.
What are the key properties of methyl 2-[(2,5-difluoro-4-nitrobenzoyl)-methylamino]acetate?
methyl 2-[(2,5-difluoro-4-nitrobenzoyl)-methylamino]acetate has a molecular weight of 288.21 g/mol, XLogP of 1.12, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(2,5-difluoro-4-nitrobenzoyl)-methylamino]acetate is sourced from PubChem (CID 115880321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).