C13H16F2N2O4 — CID 104699298
N-ethyl-2,5-difluoro-N-(1-methoxypropan-2-yl)-4-nitrobenzamide (PubChem CID 104699298) has the molecular formula C13H16F2N2O4 and a molecular weight of 302.28 g/mol. Its IUPAC name is N-ethyl-2,5-difluoro-N-(1-methoxypropan-2-yl)-4-nitrobenzamide.
| Compound Name | N-ethyl-2,5-difluoro-N-(1-methoxypropan-2-yl)-4-nitrobenzamide |
|---|---|
| PubChem CID | 104699298 |
| Molecular Formula | C13H16F2N2O4 |
| Molecular Weight | 302.28 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | N-ethyl-2,5-difluoro-N-(1-methoxypropan-2-yl)-4-nitrobenzamide |
| SMILES | CCN(C(=O)c1cc(F)c([N+](=O)[O-])cc1F)C(C)COC |
| InChI | InChI=1S/C13H16F2N2O4/c1-4-16(8(2)7-21-3)13(18)9-5-11(15)12(17(19)20)6-10(9)14/h5-6,8H,4,7H2,1-3H3 |
| InChIKey | LWZVRDZGJNJLFC-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.28 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|