C11H14N4O6 — CID 174370510
2-[(2,3-dihydroxy-7-nitro-1,2,3,4-tetrahydroquinoxalin-5-yl)methylamino]acetic acid (PubChem CID 174370510) has the molecular formula C11H14N4O6 and a molecular weight of 298.26 g/mol. Its IUPAC name is 2-[(2,3-dihydroxy-7-nitro-1,2,3,4-tetrahydroquinoxalin-5-yl)methylamino]acetic acid.
| Compound Name | 2-[(2,3-dihydroxy-7-nitro-1,2,3,4-tetrahydroquinoxalin-5-yl)methylamino]acetic acid |
|---|---|
| PubChem CID | 174370510 |
| Molecular Formula | C11H14N4O6 |
| Molecular Weight | 298.26 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | 2-[(2,3-dihydroxy-7-nitro-1,2,3,4-tetrahydroquinoxalin-5-yl)methylamino]acetic acid |
| SMILES | O=C(O)CNCc1cc([N+](=O)[O-])cc2c1NC(O)C(O)N2 |
| InChI | InChI=1S/C11H14N4O6/c16-8(17)4-12-3-5-1-6(15(20)21)2-7-9(5)14-11(19)10(18)13-7/h1-2,10-14,18-19H,3-4H2,(H,16,17) |
| InChIKey | FQDXSLSDXIFOTF-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 156.99 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.26 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|