C9H9FN2O4 — CID 107350087
2-[(2-fluoro-3-nitrophenyl)methylamino]acetic acid (PubChem CID 107350087) has the molecular formula C9H9FN2O4 and a molecular weight of 228.18 g/mol. Its IUPAC name is 2-[(2-fluoro-3-nitrophenyl)methylamino]acetic acid.
| Compound Name | 2-[(2-fluoro-3-nitrophenyl)methylamino]acetic acid |
|---|---|
| PubChem CID | 107350087 |
| Molecular Formula | C9H9FN2O4 |
| Molecular Weight | 228.18 g/mol |
| Exact Mass | 228.05 |
| IUPAC Name | 2-[(2-fluoro-3-nitrophenyl)methylamino]acetic acid |
| SMILES | O=C(O)CNCc1cccc([N+](=O)[O-])c1F |
| InChI | InChI=1S/C9H9FN2O4/c10-9-6(4-11-5-8(13)14)2-1-3-7(9)12(15)16/h1-3,11H,4-5H2,(H,13,14) |
| InChIKey | PCLFMNFFOUOXOX-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.18 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|