C11H12F4N2O2 — CID 107349368
4,4,4-trifluoro-N-[(2-fluoro-3-nitrophenyl)methyl]butan-1-amine (PubChem CID 107349368) has the molecular formula C11H12F4N2O2 and a molecular weight of 280.22 g/mol. Its IUPAC name is 4,4,4-trifluoro-N-[(2-fluoro-3-nitrophenyl)methyl]butan-1-amine.
| Compound Name | 4,4,4-trifluoro-N-[(2-fluoro-3-nitrophenyl)methyl]butan-1-amine |
|---|---|
| PubChem CID | 107349368 |
| Molecular Formula | C11H12F4N2O2 |
| Molecular Weight | 280.22 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | 4,4,4-trifluoro-N-[(2-fluoro-3-nitrophenyl)methyl]butan-1-amine |
| SMILES | O=[N+]([O-])c1cccc(CNCCCC(F)(F)F)c1F |
| InChI | InChI=1S/C11H12F4N2O2/c12-10-8(3-1-4-9(10)17(18)19)7-16-6-2-5-11(13,14)15/h1,3-4,16H,2,5-7H2 |
| InChIKey | NKYIPWGYIVJJER-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.22 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|