C11H12ClF3N2O2 — CID 79039573
N-[(5-chloro-2-nitrophenyl)methyl]-4,4,4-trifluorobutan-1-amine (PubChem CID 79039573) has the molecular formula C11H12ClF3N2O2 and a molecular weight of 296.68 g/mol. Its IUPAC name is N-[(5-chloro-2-nitrophenyl)methyl]-4,4,4-trifluorobutan-1-amine.
| Compound Name | N-[(5-chloro-2-nitrophenyl)methyl]-4,4,4-trifluorobutan-1-amine |
|---|---|
| PubChem CID | 79039573 |
| Molecular Formula | C11H12ClF3N2O2 |
| Molecular Weight | 296.68 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | N-[(5-chloro-2-nitrophenyl)methyl]-4,4,4-trifluorobutan-1-amine |
| SMILES | O=[N+]([O-])c1ccc(Cl)cc1CNCCCC(F)(F)F |
| InChI | InChI=1S/C11H12ClF3N2O2/c12-9-2-3-10(17(18)19)8(6-9)7-16-5-1-4-11(13,14)15/h2-3,6,16H,1,4-5,7H2 |
| InChIKey | LJYMIAANALIOGZ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.68 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|