C9H8ClF3N2O3 — CID 82722495
1-(5-chloro-2-nitrophenyl)-N-(2,2,2-trifluoroethoxy)methanamine (PubChem CID 82722495) has the molecular formula C9H8ClF3N2O3 and a molecular weight of 284.62 g/mol. Its IUPAC name is 1-(5-chloro-2-nitrophenyl)-N-(2,2,2-trifluoroethoxy)methanamine.
| Compound Name | 1-(5-chloro-2-nitrophenyl)-N-(2,2,2-trifluoroethoxy)methanamine |
|---|---|
| PubChem CID | 82722495 |
| Molecular Formula | C9H8ClF3N2O3 |
| Molecular Weight | 284.62 g/mol |
| Exact Mass | 284.02 |
| IUPAC Name | 1-(5-chloro-2-nitrophenyl)-N-(2,2,2-trifluoroethoxy)methanamine |
| SMILES | O=[N+]([O-])c1ccc(Cl)cc1CNOCC(F)(F)F |
| InChI | InChI=1S/C9H8ClF3N2O3/c10-7-1-2-8(15(16)17)6(3-7)4-14-18-5-9(11,12)13/h1-3,14H,4-5H2 |
| InChIKey | RSXSFXVTVWBNGG-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.62 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|