C12H13F5N2O2 — CID 115517478
N-[(2,4-difluoro-5-nitrophenyl)methyl]-5,5,5-trifluoropentan-1-amine (PubChem CID 115517478) has the molecular formula C12H13F5N2O2 and a molecular weight of 312.24 g/mol. Its IUPAC name is N-[(2,4-difluoro-5-nitrophenyl)methyl]-5,5,5-trifluoropentan-1-amine.
| Compound Name | N-[(2,4-difluoro-5-nitrophenyl)methyl]-5,5,5-trifluoropentan-1-amine |
|---|---|
| PubChem CID | 115517478 |
| Molecular Formula | C12H13F5N2O2 |
| Molecular Weight | 312.24 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | N-[(2,4-difluoro-5-nitrophenyl)methyl]-5,5,5-trifluoropentan-1-amine |
| SMILES | O=[N+]([O-])c1cc(CNCCCCC(F)(F)F)c(F)cc1F |
| InChI | InChI=1S/C12H13F5N2O2/c13-9-6-10(14)11(19(20)21)5-8(9)7-18-4-2-1-3-12(15,16)17/h5-6,18H,1-4,7H2 |
| InChIKey | BYZXFLLSKZVZKL-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.24 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|