C11H12F2N2O4 — CID 54920866
4-[(2,4-difluoro-5-nitrophenyl)methylamino]butanoic acid (PubChem CID 54920866) has the molecular formula C11H12F2N2O4 and a molecular weight of 274.22 g/mol. Its IUPAC name is 4-[(2,4-difluoro-5-nitrophenyl)methylamino]butanoic acid.
| Compound Name | 4-[(2,4-difluoro-5-nitrophenyl)methylamino]butanoic acid |
|---|---|
| PubChem CID | 54920866 |
| Molecular Formula | C11H12F2N2O4 |
| Molecular Weight | 274.22 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 4-[(2,4-difluoro-5-nitrophenyl)methylamino]butanoic acid |
| SMILES | O=C(O)CCCNCc1cc([N+](=O)[O-])c(F)cc1F |
| InChI | InChI=1S/C11H12F2N2O4/c12-8-5-9(13)10(15(18)19)4-7(8)6-14-3-1-2-11(16)17/h4-5,14H,1-3,6H2,(H,16,17) |
| InChIKey | RUMQLTROQUJASE-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.22 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|