C9H9F2N3O4 — CID 112672828
2-[(2,4-difluoro-5-nitrophenyl)methylamino]oxyacetamide (PubChem CID 112672828) has the molecular formula C9H9F2N3O4 and a molecular weight of 261.18 g/mol. Its IUPAC name is 2-[(2,4-difluoro-5-nitrophenyl)methylamino]oxyacetamide.
| Compound Name | 2-[(2,4-difluoro-5-nitrophenyl)methylamino]oxyacetamide |
|---|---|
| PubChem CID | 112672828 |
| Molecular Formula | C9H9F2N3O4 |
| Molecular Weight | 261.18 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | 2-[(2,4-difluoro-5-nitrophenyl)methylamino]oxyacetamide |
| SMILES | NC(=O)CONCc1cc([N+](=O)[O-])c(F)cc1F |
| InChI | InChI=1S/C9H9F2N3O4/c10-6-2-7(11)8(14(16)17)1-5(6)3-13-18-4-9(12)15/h1-2,13H,3-4H2,(H2,12,15) |
| InChIKey | DVENMWGQKPNVDN-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 107.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.18 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|