C13H16F2N2O4 — CID 43776172
methyl (2S)-2-[(2,4-difluoro-5-nitrophenyl)methylamino]-3-methylbutanoate (PubChem CID 43776172) has the molecular formula C13H16F2N2O4 and a molecular weight of 302.28 g/mol. Its IUPAC name is methyl (2S)-2-[(2,4-difluoro-5-nitrophenyl)methylamino]-3-methylbutanoate.
| Compound Name | methyl (2S)-2-[(2,4-difluoro-5-nitrophenyl)methylamino]-3-methylbutanoate |
|---|---|
| PubChem CID | 43776172 |
| Molecular Formula | C13H16F2N2O4 |
| Molecular Weight | 302.28 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | methyl (2S)-2-[(2,4-difluoro-5-nitrophenyl)methylamino]-3-methylbutanoate |
| SMILES | COC(=O)[C@@H](NCc1cc([N+](=O)[O-])c(F)cc1F)C(C)C |
| InChI | InChI=1S/C13H16F2N2O4/c1-7(2)12(13(18)21-3)16-6-8-4-11(17(19)20)10(15)5-9(8)14/h4-5,7,12,16H,6H2,1-3H3/t12-/m0/s1 |
| InChIKey | OJAKRSIIDNGZSD-LBPRGKRZSA-N |
| XLogP | 2.16 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.28 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|