C18H26N2O6 — CID 142666167
methyl 2-[[5-(2,2-dimethylpropanoyloxy)-2-nitrophenyl]methylamino]-3-methylbutanoate (PubChem CID 142666167) has the molecular formula C18H26N2O6 and a molecular weight of 366.41 g/mol. Its IUPAC name is methyl 2-[[5-(2,2-dimethylpropanoyloxy)-2-nitrophenyl]methylamino]-3-methylbutanoate.
| Compound Name | methyl 2-[[5-(2,2-dimethylpropanoyloxy)-2-nitrophenyl]methylamino]-3-methylbutanoate |
|---|---|
| PubChem CID | 142666167 |
| Molecular Formula | C18H26N2O6 |
| Molecular Weight | 366.41 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | methyl 2-[[5-(2,2-dimethylpropanoyloxy)-2-nitrophenyl]methylamino]-3-methylbutanoate |
| SMILES | COC(=O)C(NCc1cc(OC(=O)C(C)(C)C)ccc1[N+](=O)[O-])C(C)C |
| InChI | InChI=1S/C18H26N2O6/c1-11(2)15(16(21)25-6)19-10-12-9-13(7-8-14(12)20(23)24)26-17(22)18(3,4)5/h7-9,11,15,19H,10H2,1-6H3 |
| InChIKey | ZVLZJVTYADLHDT-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.41 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|