C16H22N2O6 — CID 166335315
(5-methoxy-2-nitrophenyl)methyl (2R)-2-acetamido-3,3-dimethylbutanoate (PubChem CID 166335315) has the molecular formula C16H22N2O6 and a molecular weight of 338.36 g/mol. Its IUPAC name is (5-methoxy-2-nitrophenyl)methyl (2R)-2-acetamido-3,3-dimethylbutanoate.
| Compound Name | (5-methoxy-2-nitrophenyl)methyl (2R)-2-acetamido-3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 166335315 |
| Molecular Formula | C16H22N2O6 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | (5-methoxy-2-nitrophenyl)methyl (2R)-2-acetamido-3,3-dimethylbutanoate |
| SMILES | COc1ccc([N+](=O)[O-])c(COC(=O)[C@H](NC(C)=O)C(C)(C)C)c1 |
| InChI | InChI=1S/C16H22N2O6/c1-10(19)17-14(16(2,3)4)15(20)24-9-11-8-12(23-5)6-7-13(11)18(21)22/h6-8,14H,9H2,1-5H3,(H,17,19)/t14-/m0/s1 |
| InChIKey | DBTCPFSSCGZFMB-AWEZNQCLSA-N |
| XLogP | 2.20 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|