C14H13F2N3O2 — CID 81391936
(1S)-N-[(2,4-difluoro-5-nitrophenyl)methyl]-1-pyridin-3-ylethanamine (PubChem CID 81391936) has the molecular formula C14H13F2N3O2 and a molecular weight of 293.27 g/mol. Its IUPAC name is (1S)-N-[(2,4-difluoro-5-nitrophenyl)methyl]-1-pyridin-3-ylethanamine.
| Compound Name | (1S)-N-[(2,4-difluoro-5-nitrophenyl)methyl]-1-pyridin-3-ylethanamine |
|---|---|
| PubChem CID | 81391936 |
| Molecular Formula | C14H13F2N3O2 |
| Molecular Weight | 293.27 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | (1S)-N-[(2,4-difluoro-5-nitrophenyl)methyl]-1-pyridin-3-ylethanamine |
| SMILES | C[C@H](NCc1cc([N+](=O)[O-])c(F)cc1F)c1cccnc1 |
| InChI | InChI=1S/C14H13F2N3O2/c1-9(10-3-2-4-17-7-10)18-8-11-5-14(19(20)21)13(16)6-12(11)15/h2-7,9,18H,8H2,1H3/t9-/m0/s1 |
| InChIKey | KSJUXJGOKMLSJB-VIFPVBQESA-N |
| XLogP | 3.12 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.27 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|