3-[(2,4,5-trifluorophenyl)methylamino]propanoic acid

C10H10F3NO2 — CID 18618366

IUPAC3-[(2,4,5-trifluorophenyl)methylamino]propanoic acid
SMILESO=C(O)CCNCc1cc(F)c(F)cc1F
InChIInChI=1S/C10H10F3NO2/c11-7-4-9(13)8(12)3-6(7)5-14-2-1-10(15)16/h3-4,14H,1-2,5H2,(H,15,16)
InChIKeyYFRXFASOSKAVKE-UHFFFAOYSA-N
MW233.19 g/mol
LogP1.67
Rot. Bonds5

About 3-[(2,4,5-trifluorophenyl)methylamino]propanoic acid

3-[(2,4,5-trifluorophenyl)methylamino]propanoic acid (PubChem CID 18618366) has the molecular formula C10H10F3NO2 and a molecular weight of 233.19 g/mol. Its IUPAC name is 3-[(2,4,5-trifluorophenyl)methylamino]propanoic acid.

Molecular Properties

Compound Name3-[(2,4,5-trifluorophenyl)methylamino]propanoic acid
PubChem CID18618366
Molecular FormulaC10H10F3NO2
Molecular Weight233.19 g/mol
Exact Mass233.07
IUPAC Name3-[(2,4,5-trifluorophenyl)methylamino]propanoic acid
SMILESO=C(O)CCNCc1cc(F)c(F)cc1F
InChIInChI=1S/C10H10F3NO2/c11-7-4-9(13)8(12)3-6(7)5-14-2-1-10(15)16/h3-4,14H,1-2,5H2,(H,15,16)
InChIKeyYFRXFASOSKAVKE-UHFFFAOYSA-N
XLogP1.67
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500233.19
LogP ≤ 51.67
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}

Analyze 3-[(2,4,5-trifluorophenyl)methylamino]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[(2,4,5-trifluorophenyl)methylamino]propanoic acid?
The IUPAC name of 3-[(2,4,5-trifluorophenyl)methylamino]propanoic acid (CID 18618366) is 3-[(2,4,5-trifluorophenyl)methylamino]propanoic acid.
What is the SMILES notation for 3-[(2,4,5-trifluorophenyl)methylamino]propanoic acid?
The canonical SMILES for 3-[(2,4,5-trifluorophenyl)methylamino]propanoic acid is O=C(O)CCNCc1cc(F)c(F)cc1F.
What is the InChIKey of 3-[(2,4,5-trifluorophenyl)methylamino]propanoic acid?
The InChIKey is YFRXFASOSKAVKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10F3NO2/c11-7-4-9(13)8(12)3-6(7)5-14-2-1-10(15)16/h3-4,14H,1-2,5H2,(H,15,16).
What are the key properties of 3-[(2,4,5-trifluorophenyl)methylamino]propanoic acid?
3-[(2,4,5-trifluorophenyl)methylamino]propanoic acid has a molecular weight of 233.19 g/mol, XLogP of 1.67, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2,4,5-trifluorophenyl)methylamino]propanoic acid is sourced from PubChem (CID 18618366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).