C10H10F3NO2 — CID 18618366
3-[(2,4,5-trifluorophenyl)methylamino]propanoic acid (PubChem CID 18618366) has the molecular formula C10H10F3NO2 and a molecular weight of 233.19 g/mol. Its IUPAC name is 3-[(2,4,5-trifluorophenyl)methylamino]propanoic acid.
| Compound Name | 3-[(2,4,5-trifluorophenyl)methylamino]propanoic acid |
|---|---|
| PubChem CID | 18618366 |
| Molecular Formula | C10H10F3NO2 |
| Molecular Weight | 233.19 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | 3-[(2,4,5-trifluorophenyl)methylamino]propanoic acid |
| SMILES | O=C(O)CCNCc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C10H10F3NO2/c11-7-4-9(13)8(12)3-6(7)5-14-2-1-10(15)16/h3-4,14H,1-2,5H2,(H,15,16) |
| InChIKey | YFRXFASOSKAVKE-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.19 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|