C14H18F3NO2 — CID 91127597
tert-butyl 3-[(2,4,5-trifluorophenyl)methylamino]propanoate (PubChem CID 91127597) has the molecular formula C14H18F3NO2 and a molecular weight of 289.30 g/mol. Its IUPAC name is tert-butyl 3-[(2,4,5-trifluorophenyl)methylamino]propanoate.
| Compound Name | tert-butyl 3-[(2,4,5-trifluorophenyl)methylamino]propanoate |
|---|---|
| PubChem CID | 91127597 |
| Molecular Formula | C14H18F3NO2 |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | tert-butyl 3-[(2,4,5-trifluorophenyl)methylamino]propanoate |
| SMILES | CC(C)(C)OC(=O)CCNCc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C14H18F3NO2/c1-14(2,3)20-13(19)4-5-18-8-9-6-11(16)12(17)7-10(9)15/h6-7,18H,4-5,8H2,1-3H3 |
| InChIKey | DXNXXLVDXMXSJN-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|