C15H22F2N2O2 — CID 78942148
tert-butyl N-[3-[(2,4-difluorophenyl)methylamino]propyl]carbamate (PubChem CID 78942148) has the molecular formula C15H22F2N2O2 and a molecular weight of 300.35 g/mol. Its IUPAC name is tert-butyl N-[3-[(2,4-difluorophenyl)methylamino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[(2,4-difluorophenyl)methylamino]propyl]carbamate |
|---|---|
| PubChem CID | 78942148 |
| Molecular Formula | C15H22F2N2O2 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | tert-butyl N-[3-[(2,4-difluorophenyl)methylamino]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCNCc1ccc(F)cc1F |
| InChI | InChI=1S/C15H22F2N2O2/c1-15(2,3)21-14(20)19-8-4-7-18-10-11-5-6-12(16)9-13(11)17/h5-6,9,18H,4,7-8,10H2,1-3H3,(H,19,20) |
| InChIKey | JDPILFKQQRMRGZ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|