C11H14F2N2O — CID 28684424
N-[2-[(2,4-difluorophenyl)methylamino]ethyl]acetamide (PubChem CID 28684424) has the molecular formula C11H14F2N2O and a molecular weight of 228.24 g/mol. Its IUPAC name is N-[2-[(2,4-difluorophenyl)methylamino]ethyl]acetamide.
| Compound Name | N-[2-[(2,4-difluorophenyl)methylamino]ethyl]acetamide |
|---|---|
| PubChem CID | 28684424 |
| Molecular Formula | C11H14F2N2O |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | N-[2-[(2,4-difluorophenyl)methylamino]ethyl]acetamide |
| SMILES | CC(=O)NCCNCc1ccc(F)cc1F |
| InChI | InChI=1S/C11H14F2N2O/c1-8(16)15-5-4-14-7-9-2-3-10(12)6-11(9)13/h2-3,6,14H,4-5,7H2,1H3,(H,15,16) |
| InChIKey | JBDPTFJNJZUAAM-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|