C11H15FN2O2 — CID 112606322
N-[2-[(3-fluoro-2-hydroxyphenyl)methylamino]ethyl]acetamide (PubChem CID 112606322) has the molecular formula C11H15FN2O2 and a molecular weight of 226.25 g/mol. Its IUPAC name is N-[2-[(3-fluoro-2-hydroxyphenyl)methylamino]ethyl]acetamide.
| Compound Name | N-[2-[(3-fluoro-2-hydroxyphenyl)methylamino]ethyl]acetamide |
|---|---|
| PubChem CID | 112606322 |
| Molecular Formula | C11H15FN2O2 |
| Molecular Weight | 226.25 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | N-[2-[(3-fluoro-2-hydroxyphenyl)methylamino]ethyl]acetamide |
| SMILES | CC(=O)NCCNCc1cccc(F)c1O |
| InChI | InChI=1S/C11H15FN2O2/c1-8(15)14-6-5-13-7-9-3-2-4-10(12)11(9)16/h2-4,13,16H,5-7H2,1H3,(H,14,15) |
| InChIKey | LKYJVWKJCFBRRV-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.25 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|