C12H19N3O3 — CID 83116209
3-[2-[(2,3-dihydroxyphenyl)methylamino]ethyl]-1,1-dimethylurea (PubChem CID 83116209) has the molecular formula C12H19N3O3 and a molecular weight of 253.30 g/mol. Its IUPAC name is 3-[2-[(2,3-dihydroxyphenyl)methylamino]ethyl]-1,1-dimethylurea.
| Compound Name | 3-[2-[(2,3-dihydroxyphenyl)methylamino]ethyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 83116209 |
| Molecular Formula | C12H19N3O3 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | 3-[2-[(2,3-dihydroxyphenyl)methylamino]ethyl]-1,1-dimethylurea |
| SMILES | CN(C)C(=O)NCCNCc1cccc(O)c1O |
| InChI | InChI=1S/C12H19N3O3/c1-15(2)12(18)14-7-6-13-8-9-4-3-5-10(16)11(9)17/h3-5,13,16-17H,6-8H2,1-2H3,(H,14,18) |
| InChIKey | QLHQDUHHZUFFAW-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|