C11H16N2O3 — CID 61319309
4-[(2,3-dihydroxyphenyl)methylamino]butanamide (PubChem CID 61319309) has the molecular formula C11H16N2O3 and a molecular weight of 224.26 g/mol. Its IUPAC name is 4-[(2,3-dihydroxyphenyl)methylamino]butanamide.
| Compound Name | 4-[(2,3-dihydroxyphenyl)methylamino]butanamide |
|---|---|
| PubChem CID | 61319309 |
| Molecular Formula | C11H16N2O3 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | 4-[(2,3-dihydroxyphenyl)methylamino]butanamide |
| SMILES | NC(=O)CCCNCc1cccc(O)c1O |
| InChI | InChI=1S/C11H16N2O3/c12-10(15)5-2-6-13-7-8-3-1-4-9(14)11(8)16/h1,3-4,13-14,16H,2,5-7H2,(H2,12,15) |
| InChIKey | ISRFGLLFWPEGTB-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|