C12H17N3O4 — CID 57029014
(2R)-2-[(2,3-dihydroxyphenyl)methylamino]pentanediamide (PubChem CID 57029014) has the molecular formula C12H17N3O4 and a molecular weight of 267.28 g/mol. Its IUPAC name is (2R)-2-[(2,3-dihydroxyphenyl)methylamino]pentanediamide.
| Compound Name | (2R)-2-[(2,3-dihydroxyphenyl)methylamino]pentanediamide |
|---|---|
| PubChem CID | 57029014 |
| Molecular Formula | C12H17N3O4 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | (2R)-2-[(2,3-dihydroxyphenyl)methylamino]pentanediamide |
| SMILES | NC(=O)CC[C@@H](NCc1cccc(O)c1O)C(N)=O |
| InChI | InChI=1S/C12H17N3O4/c13-10(17)5-4-8(12(14)19)15-6-7-2-1-3-9(16)11(7)18/h1-3,8,15-16,18H,4-6H2,(H2,13,17)(H2,14,19)/t8-/m1/s1 |
| InChIKey | SRPVGXPJSQOGNB-MRVPVSSYSA-N |
| XLogP | -0.69 |
| TPSA | 138.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|