C14H20N2O3 — CID 61317470
4-[(2,3-dihydroxyphenyl)methylamino]cyclohexane-1-carboxamide (PubChem CID 61317470) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is 4-[(2,3-dihydroxyphenyl)methylamino]cyclohexane-1-carboxamide.
| Compound Name | 4-[(2,3-dihydroxyphenyl)methylamino]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 61317470 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 4-[(2,3-dihydroxyphenyl)methylamino]cyclohexane-1-carboxamide |
| SMILES | NC(=O)C1CCC(NCc2cccc(O)c2O)CC1 |
| InChI | InChI=1S/C14H20N2O3/c15-14(19)9-4-6-11(7-5-9)16-8-10-2-1-3-12(17)13(10)18/h1-3,9,11,16-18H,4-8H2,(H2,15,19) |
| InChIKey | HFADEHQRDCHHPO-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|