C15H19FN2O3 — CID 107452622
3-[[(4-carbamoylcyclohexyl)amino]methyl]-4-fluorobenzoic acid (PubChem CID 107452622) has the molecular formula C15H19FN2O3 and a molecular weight of 294.33 g/mol. Its IUPAC name is 3-[[(4-carbamoylcyclohexyl)amino]methyl]-4-fluorobenzoic acid.
| Compound Name | 3-[[(4-carbamoylcyclohexyl)amino]methyl]-4-fluorobenzoic acid |
|---|---|
| PubChem CID | 107452622 |
| Molecular Formula | C15H19FN2O3 |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | 3-[[(4-carbamoylcyclohexyl)amino]methyl]-4-fluorobenzoic acid |
| SMILES | NC(=O)C1CCC(NCc2cc(C(=O)O)ccc2F)CC1 |
| InChI | InChI=1S/C15H19FN2O3/c16-13-6-3-10(15(20)21)7-11(13)8-18-12-4-1-9(2-5-12)14(17)19/h3,6-7,9,12,18H,1-2,4-5,8H2,(H2,17,19)(H,20,21) |
| InChIKey | FBDPCXFLSHAMJV-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |